2-methylcyclopentenone manufacturers
|
| | 2-methylcyclopentenone Basic information |
| Product Name: | 2-methylcyclopentenone | | Synonyms: | 2-METHYL-2-CYCLOPENTEN-1-ONE;2-Methyl-cyclopent-2-enone;2-Cyclopenten-1-one,2-meth;2-METHYL-2-CYCLOPENTEN-1-ONE 98%;2-Methyl-1-cyclopenten-3-one;2-Methylcyclopentene-3-one;2-Methyl-2-cyclopenten-1-one,97%;2-Methyl-2-cyclopenten-1-one | | CAS: | 1120-73-6 | | MF: | C6H8O | | MW: | 96.13 | | EINECS: | 627-283-9 | | Product Categories: | C3 to C6;Carbonyl Compounds;Ketones | | Mol File: | 1120-73-6.mol |  |
| | 2-methylcyclopentenone Chemical Properties |
| Boiling point | 158-161 °C(lit.) | | density | 0.979 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.479(lit.) | | Fp | 120 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | color | Clear yellow | | InChI | InChI=1S/C6H8O/c1-5-3-2-4-6(5)7/h3H,2,4H2,1H3 | | InChIKey | ZSBWUNDRDHVNJL-UHFFFAOYSA-N | | SMILES | C1(=O)CCC=C1C | | LogP | 0.301 (est) | | CAS DataBase Reference | 1120-73-6 |
| Risk Statements | 10 | | Safety Statements | 16-27-36/37/39 | | RIDADR | UN 1224 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29142990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2-methylcyclopentenone Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID | | Uses | 2-Methyl-2-cyclopentenone is used in preparation for molecular characterization of the pyrolysis of biomass. | | Definition | ChEBI: 2-Methyl-2-cyclopenten-1-one is a cyclic ketone. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 49, p. 950, 1984 DOI: 10.1021/jo00179a044 Synthesis, p. 1009, 1984 DOI: 10.1055/s-1984-31052 | | General Description | Diels-Alder reactions of 2-methyl-2-cyclopenten-1-one with 1-ethenylhydronaphthalenes were studied. |
| | 2-methylcyclopentenone Preparation Products And Raw materials |
|