| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
- Tiopronin Impurity
-
-
2025-12-16
- CAS:85038-45-5
- Min. Order: 10mg
- Purity: 98
- Supply Ability: 100000
|
| | 2-Chloropropionylglycine Basic information |
| Product Name: | 2-Chloropropionylglycine | | Synonyms: | 2-CHLOROPROPIONYLGLYCINE;N-(2-Chloropropionyl)glycine;2-FLUOROPROPIONYLGLYCINE;(2-Chloropropionyl)aminoacetic acid;Tiopronin Impurity A;2-(2-Chloropropanamido)acetic acid;Glycine,N-(2-chloro-1-oxopropyl)-;Tiopronin Impurity I :2-Chloropropionylglycine | | CAS: | 85038-45-5 | | MF: | C5H8ClNO3 | | MW: | 165.57 | | EINECS: | | | Product Categories: | | | Mol File: | 85038-45-5.mol |  |
| | 2-Chloropropionylglycine Chemical Properties |
| Melting point | 104-106°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | CAS DataBase Reference | 85038-45-5(CAS DataBase Reference) |
| | 2-Chloropropionylglycine Usage And Synthesis |
| Uses | N-(2-Chloro-1-oxopropyl)glycine (Tiopronin Impuriy 1) is an impurity of Tiopronin (T444782), which is used as an antidote against heavy metal poisoning. |
| | 2-Chloropropionylglycine Preparation Products And Raw materials |
|