|
|
| | 4-(Acetamidomethyl)benzenesulfamide Basic information |
| Product Name: | 4-(Acetamidomethyl)benzenesulfamide | | Synonyms: | N-[(4-sulfamoylphenyl)methyl]ethanamide;N-[(4-sulfamoylphenyl)methyl]acetamide;N-(4-sulfamoylbenzyl)acetamide;p-Acetylaminomethylbenzenesulfonamide;p-Acetaminomethylbenzenesulfonamide;N-[[4-(Aminosulfonyl)phenyl]methyl]acetamide;4-(Acetamidomethyl)benzenesulfamide;ACETAMIDE, N-[[4-(AMINOSULFONYL)PHENYL]METHYL]- | | CAS: | 2015-14-7 | | MF: | C9H12N2O3S | | MW: | 228.27 | | EINECS: | 217-942-5 | | Product Categories: | | | Mol File: | 2015-14-7.mol |  |
| | 4-(Acetamidomethyl)benzenesulfamide Chemical Properties |
| Melting point | 177 °C | | density | 1.314±0.06 g/cm3(Predicted) | | pka | 10.11±0.10(Predicted) | | form | solid | | InChI | 1S/C9H12N2O3S/c1-7(12)11-6-8-2-4-9(5-3-8)15(10,13)14/h2-5H,6H2,1H3,(H,11,12)(H2,10,13,14) | | InChIKey | AHQONKCJXWTTOW-UHFFFAOYSA-N | | SMILES | O=S(C(C=C1)=CC=C1CNC(C)=O)(N)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(Acetamidomethyl)benzenesulfamide Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 4-(Acetamidomethyl)benzenesulfamide is an important intermediate in the manufacture of 4- (aminomethyl)benzenesulfonamide.
| | Production Methods | 4-(Acetamidomethyl)benzenesulfamide is produced from the sulfonyl chloride with aqueous ammonia at 15 and 70 ℃; yield 80%. |
| | 4-(Acetamidomethyl)benzenesulfamide Preparation Products And Raw materials |
|