- 6-METHOXYLUTEOLIN
-
- $1.00 / 1KG
-
2019-07-06
- CAS: 520-11-6
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | 6-METHOXYLUTEOLIN Basic information |
| Product Name: | 6-METHOXYLUTEOLIN | | Synonyms: | Eupafolin(Nepetin,NSC 122416);Eurafolin;Eupafloin
6-Methoxyluteolin;6-METHOXYLUTEOLIN;NEPETIN;2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one;2-(3-Hydroxy-4-hydroxyphenyl)-5,7-dihydroxy-6-methoxy-4H-1-benzopyran-4-one;2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-methoxy-4H-chromen-4-one | | CAS: | 520-11-6 | | MF: | C16H12O7 | | MW: | 316.26 | | EINECS: | | | Product Categories: | Tetra-substituted Flavones | | Mol File: | 520-11-6.mol |  |
| | 6-METHOXYLUTEOLIN Chemical Properties |
| Melting point | 267°C | | Boiling point | 659.1±55.0 °C(Predicted) | | density | 1.605 | | Fp | 90℃ | | storage temp. | 2-8°C | | solubility | Soluble in methanol; | | form | powder | | pka | 6.48±0.40(Predicted) | | color | Yellow | | Water Solubility | slightly soluble in water | | Major Application | food and beverages | | InChI | InChI=1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 | | InChIKey | FHHSEFRSDKWJKJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 6-METHOXYLUTEOLIN Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from the leaves of Artemisia argyi, the aerial part of the aerial part of A. syringae officinalis. | | Uses | Nepetin can be anti-tumor, insecticide, anti-SARS virus, and antibacterial. | | Biological Activity | Zelan flavonoid (6-Methoxyluteolin) is a natural flavonoid isolated from Eupatorium ballotaefolium HBK with potent anti-inflammatory activity. Nepetin inhibits IL-6, IL-8 and MCP-1 secretion in ARPE-19 cells with IC50 values of 4.43 μM, 3.42 μM and 4.17 μM, respectively.
| | target | Calcium Channel | Histamine Receptor |
| | 6-METHOXYLUTEOLIN Preparation Products And Raw materials |
|