|
|
| | 1,2-(Methylenedioxy)-4-nitrobenzene Basic information |
| | 1,2-(Methylenedioxy)-4-nitrobenzene Chemical Properties |
| Melting point | 146-148 °C (lit.) | | Boiling point | 295.67°C (rough estimate) | | density | 1.5216 (rough estimate) | | refractive index | 1.6280 (estimate) | | Fp | 289 °F | | storage temp. | Store at room temperature | | solubility | acetone: soluble2.5%, clear to slightly hazy, yellow | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | BRN | 169063 | | InChI | 1S/C7H5NO4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2 | | InChIKey | SNWQAKNKGGOVMO-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc2OCOc2c1 | | CAS DataBase Reference | 2620-44-2(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Benzodioxole, 5-nitro-(2620-44-2) | | EPA Substance Registry System | 1,3-Benzodioxole, 5-nitro- (2620-44-2) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 1,2-(Methylenedioxy)-4-nitrobenzene Usage And Synthesis |
| Chemical Properties | yellow fine crystalline powder | | Uses | 1,2-(Methylenedioxy)-4-nitrobenzene undergoes continuous hydrogenation in supercritical CO2 with poly siloxane-supported noble metal catalyst in small flow reactor. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 28, p. 625, 1991 DOI: 10.1002/jhet.5570280316 Tetrahedron, 64, p. 4999, 2008 DOI: 10.1016/j.tet.2008.03.085 | | General Description | 1,2-(Methylenedioxy)-4-nitrobenzene undergoes continuous hydrogenation in supercritical CO2 with poly siloxane-supported noble metal catalyst in small flow reactor. |
| | 1,2-(Methylenedioxy)-4-nitrobenzene Preparation Products And Raw materials |
|