|
|
| | [1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II) Basic information |
| | [1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II) Chemical Properties |
| Melting point | 285 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | green micro | | Water Solubility | Insoluble in water. | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | | InChI | InChI=1S/2C17H11P.2ClH.Fe.Ni/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;;;;/h2*1-6,9-12,18H;2*1H;;/q;;;;+2;/p-2 | | InChIKey | YLRDSVJNPNAGLK-UHFFFAOYSA-L | | SMILES | [Cl-][Ni+2]1(P(C2C=CC=CC=2)(C2C=CC=CC=2)[C-]23C4=C5C6=C2[Fe+2]27893456C3C2=C7[C-]8(C9=3)P1(C1C=CC=CC=1)C1C=CC=CC=1)[Cl-] |
| Hazard Codes | T | | Risk Statements | 45-42/43 | | Safety Statements | 53-22-36/37/39-45 | | RIDADR | 2811 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1B Resp. Sens. 1 Skin Sens. 1 |
| | [1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II) Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | diphosphine 1,1'-bis(diphenylphosphino)ferrocene (dppf) are used in transition metal-catalyzed reactions to synthesize pharmaceuticals and agrochemicals. | | Uses | suzuki reaction | | Uses | (1,1''-Bis(diphenylphosphino)ferrocene)dichloronickel(II) is an organometallic catalyst used in a variety of synthetic applications, such as the gem-difluoropropargylation of alkylzinc reagents, or cross coupling reactions to form 2,3,5,6-tetrasubstituted dehydropiperidines. | | reaction suitability | core: nickel reagent type: catalyst |
| | [1,1'-Bis(diphenylphosphino)ferrocene]dichloronickel(II) Preparation Products And Raw materials |
|