Tetraethylammonium hexafluorophosphate manufacturers
|
| | Tetraethylammonium hexafluorophosphate Basic information |
| | Tetraethylammonium hexafluorophosphate Chemical Properties |
| Melting point | ≥300 °C (lit.) | | solubility | acetonitrile: 0.1 g/mL, clear, colorless | | form | Crystalline | | Water Solubility | Soluble in water, alcohol, and acetonitrile. | | Sensitive | Hygroscopic | | BRN | 3748868 | | InChI | InChI=1S/C8H20N.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 | | InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N | | SMILES | [P-](F)(F)(F)(F)(F)F.[N+](CC)(CC)(CC)CC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN2811 | | WGK Germany | 3 | | RTECS | BS6500000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29239000 |
| | Tetraethylammonium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | Colorless crystal | | Uses | It is used extensively in electrolytes for electrochemical synthesis. | | Uses | Maintenance of fluoride atmospheres; preparation
of bactericides and fungicides. | | General Description | Visit our Sensor Applications portal to learn more. | | Hazard | Irritant to skin. | | Purification Methods | Dissolve the salt (0.8g) in hot H2O (3.3mL) and cool to crystallise. Yield of prisms is 0.5g. Its solubility in H2O is 8.1g/L at 19o [Lange & Müller Chem Ber 63 1067 1930]. [Beilstein 4 III 199.] |
| | Tetraethylammonium hexafluorophosphate Preparation Products And Raw materials |
|