- Phenyl-benzothiazole
-
- $29.00 / 1g
-
2026-01-04
- CAS:92-36-4
- Min. Order:
- Purity: 99.58%
- Supply Ability: 10g
|
| | 4-(6-Methyl-2-benzothiazolyl)benzeneamine Basic information |
| | 4-(6-Methyl-2-benzothiazolyl)benzeneamine Chemical Properties |
| Melting point | 191-196°C | | Boiling point | 434°C | | density | 1.1769 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | ≥ 24mg/mL in DMSO | | form | Flakes | | pka | 2.79±0.10(Predicted) | | color | Light yellow to green yellow | | Water Solubility | <0.1 g/100 mL at 20 ºC | | InChI | InChI=1S/C14H12N2S/c1-9-2-7-12-13(8-9)17-14(16-12)10-3-5-11(15)6-4-10/h2-8H,15H2,1H3 | | InChIKey | XRTJYEIMLZALBD-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C2=NC3=CC=C(C)C=C3S2)C=C1 | | LogP | 3.56 at 25℃ | | CAS DataBase Reference | 92-36-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 4-(6-methyl-2-benzothiazolyl)-(92-36-4) | | EPA Substance Registry System | 4-(6-Methyl-2-benzothiazolyl)aniline (92-36-4) |
| Hazard Codes | Xi | | RTECS | DL2820000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2934208090 |
| | 4-(6-Methyl-2-benzothiazolyl)benzeneamine Usage And Synthesis |
| General Description | Light tan or light orange powder. Solutions have a violet-blue fluorescence. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | 4-(6-Methyl-2-benzothiazolyl)benzeneamine is incompatible with strong oxidizing agents, acid chlorides and acid anhydrides. | | Fire Hazard | Flash point data for 4-(6-Methyl-2-benzothiazolyl)benzeneamine are not available; however, 4-(6-Methyl-2-benzothiazolyl)benzeneamine is probably combustible. |
| | 4-(6-Methyl-2-benzothiazolyl)benzeneamine Preparation Products And Raw materials |
|