|
|
| | Lactofen Basic information |
| Product Name: | Lactofen | | Synonyms: | 5-(2-CHLORO-4-TRIFLUORMETHYLPHENOXY)-2-NITROBENZYL LACTATE;1’-(carboethoxy)ethyl5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoate;-2-oxoethylester;5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitro-benzoicaci2-ethoxy-1-meth;5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitro-benzoicaci2-ethoxy-1-methyl-2-oxoethylester;5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoicacid2-ethoxy-1-methyl;Benzoicacid,5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitro-,2-ethoxy-1-methyl-2-oxoethylester;cobraherbicide | | CAS: | 77501-63-4 | | MF: | C19H15ClF3NO7 | | MW: | 461.77 | | EINECS: | 616-466-9 | | Product Categories: | Agro-Products;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 77501-63-4.mol |  |
| | Lactofen Chemical Properties |
| Melting point | approximate 48℃(dec.) | | Boiling point | 494.0±45.0 °C(Predicted) | | density | 1.4660 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | Water Solubility | 110μg/L at 20℃ | | Henry's Law Constant | 2.1×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture environmental | | InChI | 1S/C19H15ClF3NO7/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23/h4-10H,3H2,1-2H3 | | InChIKey | CONWAEURSVPLRM-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(C)OC(=O)c1cc(Oc2ccc(cc2Cl)C(F)(F)F)ccc1[N+]([O-])=O | | LogP | 4.6 at 40℃ | | CAS DataBase Reference | 77501-63-4(CAS DataBase Reference) | | EPA Substance Registry System | Lactofen (77501-63-4) |
| Hazard Codes | Xn,N | | Risk Statements | 21-51/53 | | Safety Statements | 36/37-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | RTECS | DG5643120 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Aquatic Chronic 2 | | Hazardous Substances Data | 77501-63-4(Hazardous Substances Data) |
| | Lactofen Usage And Synthesis |
| Uses | Lactofen is a complex ester derivative of Acifluoren, a diphenyl ether herbicide. Lactofen can be used in postemergence applications and is commonly used as foliar spray. Lactofen is used in agriculture to control broadleaved weeds in soybean, cereals, potatoes and peanuts. | | General Description | Dark brown to tan solid. Insoluble in water. Used as an herbicide. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Lactofen is a diphenyl ether derivative. |
| | Lactofen Preparation Products And Raw materials |
|