| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-3-(4-pyridyl)-D-alanine Basic information |
| | Fmoc-3-(4-pyridyl)-D-alanine Chemical Properties |
| Boiling point | 646.9±55.0 °C(Predicted) | | density | 1.309±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.32±0.10(Predicted) | | form | Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C23H20N2O4/c26-22(27)21(13-15-9-11-24-12-10-15)25-23(28)29-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/m1/s1 | | InChIKey | SCSSXJVRZMQUKA-OAQYLSRUSA-N | | SMILES | OC(=O)[C@@H](Cc1ccncc1)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 205528-30-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-3-(4-pyridyl)-D-alanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Fmoc-3-(4-pyridyl)-D-alanine is an Fmoc protected alanine derivative that is potentially useful for proteomics studies and solid phase peptide synthesis techniques. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-3-(4-pyridyl)-D-alanine Preparation Products And Raw materials |
|