|
|
| | 2,4,5-Trimethoxybenzoic acid Basic information |
| Product Name: | 2,4,5-Trimethoxybenzoic acid | | Synonyms: | 2,4,5-TRIMETHOXYBENZOIC ACID;Benzoic acid, 2,4,5-trimethoxy-;2,4,5-Trimethoxybenzoic acid,99%;ASARONIC ACID;AKOS BBS-00003744;RARECHEM AL BO 0322;2,4,5-trimethoxy-benzoicaci;2,4,5-Trimethoxybenzoic | | CAS: | 490-64-2 | | MF: | C10H12O5 | | MW: | 212.2 | | EINECS: | 207-715-9 | | Product Categories: | Pharmaceutical raw materials;Organic acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;bc0001 | | Mol File: | 490-64-2.mol |  |
| | 2,4,5-Trimethoxybenzoic acid Chemical Properties |
| Melting point | 143-145 °C (lit.) | | Boiling point | 300 °C | | density | 1.3006 (rough estimate) | | refractive index | 1.5140 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly) | | pka | 4.24±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | SOLUBLE | | λmax | 226nm(EtOH)(lit.) | | InChI | InChI=1S/C10H12O5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3,(H,11,12) | | InChIKey | KVZUCOGWKYOPID-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=C(OC)C=C1OC | | CAS DataBase Reference | 490-64-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2,4,5-trimethoxy- (490-64-2) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 2,4,5-Trimethoxybenzoic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | 2,4,5-Trimethoxybenzoic Acid can be used to alleviate, treat, and prevent inflammatory diseases. | | Uses | 2,4,5-Trimethoxybenzoic acid was used as internal standard during the determination of the various types of hydroxyl groups present in lignins. | | Definition | ChEBI: 2,4,5-Trimethoxybenzoic acid is a methoxybenzoic acid. |
| | 2,4,5-Trimethoxybenzoic acid Preparation Products And Raw materials |
|