| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
2-Dimethylaminobenzoic acid manufacturers
|
| | 2-Dimethylaminobenzoic acid Basic information |
| | 2-Dimethylaminobenzoic acid Chemical Properties |
| Melting point | 71-72°C | | Boiling point | 293.03°C (rough estimate) | | density | 1.1603 (rough estimate) | | refractive index | 1.5620 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 1.40±0.10(Predicted) | | color | White to Orange to Green | | Water Solubility | Insoluble in water. | | BRN | 2089466 | | InChI | InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) | | InChIKey | DVVXXHVHGGWWPE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1N(C)C | | CAS DataBase Reference | 610-16-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-(dimethylamino)- (610-16-2) |
| Provider | Language |
|
ALFA
| English |
| | 2-Dimethylaminobenzoic acid Usage And Synthesis |
| Chemical Properties | Light brown crystalline powder | | Uses | 2-Dimethylaminobenzoic acid is used as a chemical and organic intermediate. |
| | 2-Dimethylaminobenzoic acid Preparation Products And Raw materials |
|