Mersalyl acid manufacturers
|
| | Mersalyl acid Basic information |
| Product Name: | Mersalyl acid | | Synonyms: | 2-(3-HYDROXYMERCURIO-2-METHOXYPROPYLCARBAMOYL)PHENOXYACETIC ACID;MERSALYL ACID CRYSTALLINE;TIMTEC-BB SBB006336;SALYRGANIC ACID;O-[(3-HYDROXYMERCURI-2-METHOXY-PROPYL)CARBAMOYL]PHENOXYACETIC ACID;[3-[[2-(Carboxymethoxy)benzoyl]amino]-2-methoxypropyl]hydroxymercury(II);2-[N-(3-Hydroxymercuri-2-methoxypropyl)carbamoyl]phenoxyacetic acid;Merasaly Acid | | CAS: | 486-67-9 | | MF: | C13H17HgNO6 | | MW: | 483.87 | | EINECS: | 207-637-5 | | Product Categories: | | | Mol File: | 486-67-9.mol |  |
| | Mersalyl acid Chemical Properties |
| Melting point | 192-193 °C (dec.)(lit.) | | solubility | NH4OH: clear to hazy | | Merck | 13,5928 | | Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary | | InChI | 1S/C13H16NO5.Hg.H2O/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);;1H2/q;+1;/p-1 | | InChIKey | HQRSUIDICNOLPX-UHFFFAOYSA-M | | SMILES | COC(CNC(=O)c1ccccc1OCC(O)=O)C[Hg]O | | CAS DataBase Reference | 486-67-9 |
| Hazard Codes | T+,N | | Risk Statements | 26/27/28-33-50/53 | | Safety Statements | 13-28-36-45-60-61 | | RIDADR | UN 2025 6.1/PG 2 | | WGK Germany | 3 | | F | 8-10 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | Mersalyl acid Usage And Synthesis |
| Uses | Sulfhydryl specific biochemical probe. | | Definition | ChEBI: Mersalyl acid is a monocarboxylic acid. |
| | Mersalyl acid Preparation Products And Raw materials |
|