|
|
| | 4-Hydroxyisophthalic acid Basic information |
| | 4-Hydroxyisophthalic acid Chemical Properties |
| Melting point | >300°C | | Boiling point | 310 C | | density | 1.4411 (rough estimate) | | refractive index | 1.5690 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | solid | | pka | 2+-.0.10(Predicted) | | color | White to Pale Purple | | Water Solubility | 0.3g/L(24 ºC) | | Merck | 14,4827 | | Stability: | Hygroscopic | | InChI | 1S/C8H6O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) | | InChIKey | BCEQKAQCUWUNML-UHFFFAOYSA-N | | SMILES | OC(C1=CC(C(O)=O)=C(O)C=C1)=O | | CAS DataBase Reference | 636-46-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-22-36/38 | | Safety Statements | 26-36/37/39-36-39-6 | | WGK Germany | 3 | | RTECS | NT2544000 | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Hydroxyisophthalic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 4-Hydroxyisophthalic acid has been proposed as an improvement over aspirin. An impurity of Acetylsalicylic acid (A187780). Acetylsalicylic Acid Impurity B; Aspirin Impurity B | | General Description | Pharmaceutical secondary standards for application in quality control, provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards. |
| | 4-Hydroxyisophthalic acid Preparation Products And Raw materials |
|