Tradipitant manufacturers
- Tradipitant
-
-
2026-09-24
- CAS:622370-35-8
- Min. Order: 1G
- Purity: 99.99% HPLC
- Supply Ability: 1KG 5KG
- Tradipitant
-
- $55.00
-
2026-08-03
- CAS:622370-35-8
- Purity: 98.58%
- Supply Ability: 10g
|
| | Tradipitant Basic information |
| Product Name: | Tradipitant | | Synonyms: | Biafungin;Tradipitant;tradipitant,VLY-686, LY686017;[2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-pyridinyl)-1H-1,2,3-triazol-4-yl]-3-pyridinyl](2-chlorophenyl)methanone;VLY 686;(2-(1-(3,5-Bis(trifluoromethyl)benzyl)-5-(pyridin-4-yl)-1H-1,2,3-triazol-4-yl)pyridin-3-yl)(2-;Methanone, [2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-pyridinyl)-1H-1,2,3-triazol-4-yl]-3-pyridinyl](2-chlorophenyl)-;Tradipitant(VLY-686) | | CAS: | 622370-35-8 | | MF: | C28H16ClF6N5O | | MW: | 587.9 | | EINECS: | | | Product Categories: | | | Mol File: | 622370-35-8.mol |  |
| | Tradipitant Chemical Properties |
| Melting point | 143 - 145°C | | Boiling point | 640.9±65.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 2.92±0.10(Predicted) | | color | Pale Beige to Brown | | InChIKey | CAVRKWRKTNINFF-UHFFFAOYSA-N | | SMILES | C(C1=CC=CN=C1C1=C(C2C=CN=CC=2)N(CC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)N=N1)(C1=CC=CC=C1Cl)=O |
| | Tradipitant Usage And Synthesis |
| Uses | Tradipitant, is a neurokinin-1 (NK-1) antagonist. | | in vivo | Autoradiography experiments reveal that intravenously administered Tradipitant ([3H]-LY686017) localizes in the guinea pig brain and has a distribution similar to that described for the NK-1 receptor using agonist or antagonist radioligands[1]. |
| | Tradipitant Preparation Products And Raw materials |
|