- Allocryptopine
-
- $29.00 / 2mg
-
2026-04-22
- CAS:485-91-6
- Min. Order:
- Purity: 99.81%
- Supply Ability: 10g
- ALLOCRYPTOPINE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:485-91-6
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | ALLOCRYPTOPINE Basic information |
| Product Name: | ALLOCRYPTOPINE | | Synonyms: | 3,4-DIMETHOXY-6-METHYL-5,7,8,15-TETRAHYDRO-6H-BENZO[C][1,3]DIOXOLO[4',5':4,5]BENZO[1,2-G]AZECIN-14-ONE;ALLOCRYPTOPINE;ALLOCRYPTOPINE, ALPHA-;ALPHA-ALLOCRYPTOPINE;5,7,8,15-tetrahydro-3,4-dimethoxy-6-methyl[1,3]benzodioxolo[5,6-e][2]benzazecin-14(6H)-one;5,7,8,15-Tetrahydro-3,4-dimethoxy-6-methylbenzo[e][1,3]dioxolo[4,5-k][3]benzazecin-14(6H)-one;Thalictrimine;C02134 | | CAS: | 485-91-6 | | MF: | C21H23NO5 | | MW: | 369.41 | | EINECS: | 207-626-5 | | Product Categories: | Alkaloids | | Mol File: | 485-91-6.mol |  |
| | ALLOCRYPTOPINE Chemical Properties |
| Melting point | 160～161℃ | | Boiling point | 552.7±50.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 7.86±0.20(Predicted) | | color | White to Pale Brown | | InChI | InChI=1S/C21H23NO5/c1-22-7-6-14-9-19-20(27-12-26-19)10-15(14)17(23)8-13-4-5-18(24-2)21(25-3)16(13)11-22/h4-5,9-10H,6-8,11-12H2,1-3H3 | | InChIKey | HYBRYAPKQCZIAE-UHFFFAOYSA-N | | SMILES | N1(C)CC2=C(OC)C(OC)=CC=C2CC(=O)C2C=C3OCOC3=CC=2CC1 |
| | ALLOCRYPTOPINE Usage And Synthesis |
| Description | This alkaloid from Thalictrum minus has been identified as a-Allocryptopine
(q.v.). | | Uses | Allocryptopine is an alkaloid that displays antiparasitic, antiarrythmic, antithrombotic and anti-inflammatory activity. | | Definition | ChEBI: Allocryptopine is a dibenzazecine alkaloid, an organic heterotetracyclic compound, a tertiary amino compound, a cyclic ketone, a cyclic acetal and an aromatic ether. | | References | Kuchkova, Lazur'evskii., Izv. Akad. Nauk. Mold. SSR, Ser. Khim. Bioi., II,
43 (196S) |
| | ALLOCRYPTOPINE Preparation Products And Raw materials |
|