|
|
| | DIURON D6 Basic information |
| | DIURON D6 Chemical Properties |
| Melting point | 147-150C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol | | form | Solid | | color | White to off-white | | Major Application | agriculture
environmental | | InChI | 1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14)/i1D3,2D3 | | InChIKey | XMTQQYYKAHVGBJ-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])N(C(=O)Nc1ccc(Cl)c(Cl)c1)C([2H])([2H])[2H] |
| Hazard Codes | Xn,N | | Risk Statements | 22-40-48/22-50/53 | | Safety Statements | 13-22-23-37-46-60-61-36/37 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
STOT RE 2 Inhalation |
| | DIURON D6 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A labelled phenyl urea herbicide |
| | DIURON D6 Preparation Products And Raw materials |
|