| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,6-Dichloropyridazine-4-carboxylic acid Basic information | | Synthesis |
| Product Name: | 3,6-Dichloropyridazine-4-carboxylic acid | | Synonyms: | 3,6-Dichloro-4-pyridazine...;4-Carboxy-3,6-dichloropyridazine;3,6-dichloro-4-pyridazinecarboxylic acid;3,6-Dichloropyridazine-4-Carbo;3,6-DICHLOROPYRIDAZINE-4-CA;3,6-DICHLOROPYRIDAZINE-4-CARBOXYLIC;3,6-Dichloropyridazine-4-carboxylic acid 98%;4-Pyridazinecarboxylic acid, 3,6-dichloro- | | CAS: | 51149-08-7 | | MF: | C5H2Cl2N2O2 | | MW: | 192.99 | | EINECS: | 628-653-2 | | Product Categories: | Carboxylic Acids;Pyrazines, Pyrimidines & Pyridazines;Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyridazines;PyridazinesHeterocyclic Building Blocks | | Mol File: | 51149-08-7.mol |  |
| | 3,6-Dichloropyridazine-4-carboxylic acid Chemical Properties |
| Melting point | 142 °C (dec.) (lit.) | | Boiling point | 424.8±40.0 °C(Predicted) | | density | 1.718±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 0.59±0.32(Predicted) | | form | Powder or Crystalline Powder | | color | White to off-white | | BRN | 610056 | | InChI | InChI=1S/C5H2Cl2N2O2/c6-3-1-2(5(10)11)4(7)9-8-3/h1H,(H,10,11) | | InChIKey | FRCXPDWDMAYSCE-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(Cl)C=C1C(O)=O | | CAS DataBase Reference | 51149-08-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,6-Dichloropyridazine-4-carboxylic acid Usage And Synthesis |
| Synthesis | 3,6-Dichloropyridazine-4-carboxylic acid is a pharmaceutical intermediate that can be prepared from citrate anhydride as a starting material. First, 4-methylpyridazine-3,6-diol is prepared, then chlorinated to obtain 3,6-dichloro-4-methylpyridazine, and finally, the methyl group is oxidized to yield 3,6-dichloropyridazine-4-carboxylic acid. 
| | Chemical Properties | White solid | | Uses | 3,6-Dichloropyridazine-4-carboxylic acid has been used in the synthesis of α-(halohetaroyl)-2-azahetarylacetonitriles. |
| | 3,6-Dichloropyridazine-4-carboxylic acid Preparation Products And Raw materials |
|