- mPEG8-OH
-
- $0.00 / 1g
-
2026-01-28
- CAS:25990-96-9
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | Octaethylene Glycol Monomethyl Ether Basic information |
| Product Name: | Octaethylene Glycol Monomethyl Ether | | Synonyms: | OCTAETHYLENE GLYCOL MONOMETHYL EHTER;MPEG8-OH;MPEG-8;Octaethylene Glycol MonoMethyl Ethe;2,5,8,11,14,17,20,23-octaoxapentacosan-25-ol;OCTAETHYLENE GLYCOL MONOMETHYL ETHER;3,6,9,12,15,18,21,24-Octaoxapentacosan-1-ol;Methyl-PEG18 | | CAS: | 25990-96-9 | | MF: | C17H36O9 | | MW: | 384.46 | | EINECS: | | | Product Categories: | Ethylene Glycols & Monofunctional Ethylene Glycols;Monofunctional Ethylene Glycols;peg | | Mol File: | 25990-96-9.mol |  |
| | Octaethylene Glycol Monomethyl Ether Chemical Properties |
| Boiling point | 216 °C / 2mmHg | | density | 1.09 | | refractive index | 1.4560 to 1.4600 | | storage temp. | 2-8°C | | form | clear liquid | | pka | 14.36±0.10(Predicted) | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C17H36O9/c1-19-4-5-21-8-9-23-12-13-25-16-17-26-15-14-24-11-10-22-7-6-20-3-2-18/h18H,2-17H2,1H3 | | InChIKey | SZGNWRSFHADOMY-UHFFFAOYSA-N | | SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOC |
| | Octaethylene Glycol Monomethyl Ether Usage And Synthesis |
| Description | m-PEG8-alcohol is a PEG linker containing a hydroxyl group. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | Octaethylene glycol monomethyl ether is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | | IC 50 | PEGs |
| | Octaethylene Glycol Monomethyl Ether Preparation Products And Raw materials |
|