|
|
| | UDPGA TRISODIUM SALT Basic information |
| Product Name: | UDPGA TRISODIUM SALT | | Synonyms: | UDPGA Na;URIDINE[5']DIPHOSPHO[1]-ALPHA-D-GLUCOPYRANOSURONIC ACID TRISODIUM SALT;UDPGA 3NA;UDPGA TRISODIUM SALT;UDP-GLUCURONIC ACID TRISODIUM SALT;URIDINE 5'-DIPHOSPHOGLUCURONIC ACID*TRIS ODIUM;URIDINE-5'-DIPHOSPHO-GLUCURONIC ACID, TRISODIUM SALT 98-100%;.alpha.-D-Glucopyranuronic acid, 1?P-ester with uridine 5-(trihydrogen diphosphate), trisodium salt | | CAS: | 63700-19-6 | | MF: | C15H23N2NaO18P2 | | MW: | 604.28 | | EINECS: | | | Product Categories: | | | Mol File: | 63700-19-6.mol |  |
| | UDPGA TRISODIUM SALT Chemical Properties |
| Melting point | >175oC (dec.) | | storage temp. | -20°C | | solubility | H2O: 10 mg/mL, clear, colorless | | form | Solid | | color | White to Off-WHite | | biological source | bovine liver
rabbit muscle
yeast | | Stability: | Hygroscopic | | InChIKey | SLLHKYVCELYFCN-UBOOCJFONA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,14,15,16,18,20,27,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | UDPGA TRISODIUM SALT Usage And Synthesis |
| Uses | Trisodium UDP-glucuronic Acid is a reactant used in the enzymatic preparation of β-glucuronides. | | Biochem/physiol Actions | Uridine 5′-diphosphate-glucuronic acid (UDP-GlcA) is a carboxylic acid-formed sugar nucleotide. It participates in the biosynthesis of numerous cell components. UDP-GlcA is a glycosyl donor for glycosyltransferases in the biosynthesis of several cell components like glycosaminoglycans, some N- and O-linked glycans, glycosphingolipids and pectins. |
| | UDPGA TRISODIUM SALT Preparation Products And Raw materials |
|