|
|
| | 4-Chloro-N-methylpicolinamide Basic information |
| | 4-Chloro-N-methylpicolinamide Chemical Properties |
| Melting point | 41-43°C | | Boiling point | 317.8±27.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly), Met | | form | Solid | | pka | 13.41±0.46(Predicted) | | color | Off-White to Light Yellow | | InChI | InChI=1S/C7H7ClN2O/c1-9-7(11)6-4-5(8)2-3-10-6/h2-4H,1H3,(H,9,11) | | InChIKey | BGVBBMZMEKXUTR-UHFFFAOYSA-N | | SMILES | C1(C(NC)=O)=NC=CC(Cl)=C1 | | CAS DataBase Reference | 220000-87-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | HS Code | 2933399990 |
| Provider | Language |
|
ALFA
| English |
| | 4-Chloro-N-methylpicolinamide Usage And Synthesis |
| Description | 4-Chloro-N-methylpicolinamide is a polar organic compound that interacts with hydrogen bonds. It has been shown to inhibit the value-added of cancer cells by inhibiting protein synthesis to inhibit the growth of human hepatocellular carcinoma cells, bcr/abl kinase, and hct116 cells, and is a candidate for cancer treatment. Studies have shown that it also inhibits the proliferation of MDA-MB231 breast cancer cells by blocking growth factor activity. In addition, 4-Chloro-N-methylpicolinamide is a pharmaceutical intermediate component used in the preparation of the antineoplastic drugs regorafenib and sorafenib. | | Chemical Properties | Pale-Yellow Solid | | Uses | 4-Chloro-N-methylpyridine-2-carboxamide (>90%) (cas# 220000-87-3) is a compound useful in organic synthesis. |
| | 4-Chloro-N-methylpicolinamide Preparation Products And Raw materials |
|