| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
2,4-Dimethyl-3-pentanol manufacturers
|
| | 2,4-Dimethyl-3-pentanol Basic information |
| | 2,4-Dimethyl-3-pentanol Chemical Properties |
| Melting point | -70°C | | Boiling point | 139-140 °C (lit.) | | density | 0.829 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.425(lit.) | | Fp | 99 °F | | storage temp. | Store at room temperature | | form | clear liquid | | pka | 15.04±0.20(Predicted) | | color | Colorless to Almost colorless | | Water Solubility | 32.4 g/L (20 ºC) | | BRN | 1731593 | | Henry's Law Constant | 4.0×10-1 mol/(m3Pa) at 25℃, Yaffe et al. (2003) | | InChI | InChI=1S/C7H16O/c1-5(2)7(8)6(3)4/h5-8H,1-4H3 | | InChIKey | BAYAKMPRFGNNFW-UHFFFAOYSA-N | | SMILES | CC(C)C(O)C(C)C | | LogP | 1.899 (est) | | CAS DataBase Reference | 600-36-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Pentanol, 2,4-dimethyl-(600-36-2) | | EPA Substance Registry System | 2,4-Dimethyl-3-pentanol (600-36-2) |
| Hazard Codes | Xn | | Risk Statements | 10-22-37/38-41 | | Safety Statements | 16-26-39 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | RTECS | SA6660000 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29051990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 2,4-Dimethyl-3-pentanol Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 2,4-Dimethyl-3-pentanol was used as a proton source in the diastereoselective coupling with 2-substituted acrylate derivatives. It was used in the polymerization of 1,1′-(1,3-phenylene) diethanol (1,3-diol) and diisopropyl adipate. |
| | 2,4-Dimethyl-3-pentanol Preparation Products And Raw materials |
| Raw materials | 3-Hexene, 2,5-dimethyl-3,4-bis(1-methylethyl)--->2,4-Dimethyl-3-pentanol acetate-->2,4-Dimethyl-3-isopropyl-3-pentanol-->2,4-Dimethyl-2-pentene-->2,4-Dimethyl-3-pentanone | | Preparation Products | 3-Hexanol, 2-methyl-3-(1-methylethyl)--->2,2,4-Trimethyl-1,3-pentanediol-->Tetrahydropyran-->2.2.4-Trimethyl-1-pentanol-->2,4-Dimethylpentane |
|