| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methylbenzyl cyanide Basic information |
| | 4-Methylbenzyl cyanide Chemical Properties |
| Melting point | 18 °C(lit.) | | Boiling point | 242-243 °C(lit.) | | density | 0.992 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.519(lit.) | | Fp | 223 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | Specific Gravity | 0.99 | | color | Clear colorless to faintly yellow | | BRN | 1099645 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C9H9N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6H2,1H3 | | InChIKey | RNHKXHKUKJXLAU-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=C(C)C=C1 | | CAS DataBase Reference | 2947-61-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetonitrile, 4-methyl-(2947-61-7) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37-24/25 | | RIDADR | UN 3276 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 3 |
| | 4-Methylbenzyl cyanide Usage And Synthesis |
| Chemical Properties | Clear colorless to faintly yellow liquid | | Uses | 4-Methylbenzyl cyanide is used as an intermediate in fragrances, dyes and pharmaceuticals. | | Synthesis Reference(s) | Synthesis, p. 40, 1987 DOI: 10.1055/s-1987-27834 |
| | 4-Methylbenzyl cyanide Preparation Products And Raw materials |
|