| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | Acrolein 2,4-dinitrophenylhydrazone Basic information |
| Product Name: | Acrolein 2,4-dinitrophenylhydrazone | | Synonyms: | 2-PROPENAL 2,4-DINITROPHENYLHYDRAZONE;ACROLEIN-DNPH;ACROLEIN-2,4-DNPH, 25MG, NEAT;68665, Acrolein 2,4-dinitrophenylhydrazo ne (purity);ACROLEIN-DNPH, 1X1ML, ACN 1000UG/ML;acrolein-2,4-dinitrophenylhydrazone solution;acrolein-2,4-dnph;acrolein-2,4-dnph solution | | CAS: | 888-54-0 | | MF: | C9H8N4O4 | | MW: | 236.18 | | EINECS: | 626-989-4 | | Product Categories: | Aromatics;Intermediates;A;NeatsCertified Reference Materials (CRMs);Occupational Hygiene CRM;Miscellaneous Reagents;AA to ALCertified Reference Materials (CRMs);Air MonitoringChemical Class;Aldehydes/DNPH;Alphabetic;Application CRMs | | Mol File: | 888-54-0.mol |  |
| | Acrolein 2,4-dinitrophenylhydrazone Chemical Properties |
| Melting point | 221-222℃ | | Boiling point | 392.8±42.0 °C(Predicted) | | density | 1.40 | | Fp | 2 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Sonicated), Methanol (Slightly, Sonicated) | | pka | 11.74±0.10(Predicted) | | color | Orange to Very Dark Orange | | BRN | 5343581 | | Stability: | Light Sensitive | | Major Application | environmental | | InChI | InChI=1S/C9H8N4O4/c1-2-5-10-11-8-4-3-7(12(14)15)6-9(8)13(16)17/h2-6,11H,1H2 | | InChIKey | JJPZHGIYUVFTGG-BJMVGYQFSA-N | | SMILES | C(=NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O)C=C |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 36/37/38-36-20/21/22-11 | | Safety Statements | 26-36/37-16 | | RIDADR | UN 1648 3/PG 2 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29280000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | Acrolein 2,4-dinitrophenylhydrazone Usage And Synthesis |
| Uses | Acrolein 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke. |
| | Acrolein 2,4-dinitrophenylhydrazone Preparation Products And Raw materials |
|