|
|
| | Poly(ethylene glycol) diacrylate Basic information |
| Product Name: | Poly(ethylene glycol) diacrylate | | Synonyms: | Poly(ethylene glycol) diacrylate average Mn 1,000, contains MEHQ as inhibitor;Poly(ethylene glycol) diacrylate average Mn 20,000, contains <=100 ppm MEHQ as inhibitor;Poly(ethylene glycol) diacrylate average Mn 6,000, contains <=1500 ppm MEHQ as inhibitor;Poly(ethylene glycol) diacrylate (Mn 2000);1,2-Ethanediyl bisacrylate;2-ethanediyl),.alpha.-(1-oxo-2-propenyl)-.omega.-[(1-oxo-2-propenyl)oxy]-Poly(oxy-1;poly(oxy-1,2-ethanediyl),alpha-(1-oxo-2-propenyl)-omega-[(1-oxo-2-propenyl)o;xy]- | | CAS: | 26570-48-9 | | MF: | C5H10O4 | | MW: | 134.1305 | | EINECS: | 251-228-4 | | Product Categories: | Polydispersed PEG;Acrylate;Biomaterials;Crosslinking Agents;Homobifunctional PEGs;Materials Science;Poly(ethylene glycol) and Poly(ethylene oxide);Polymer Science;Polymers;Homobifunctional PEGs;Materials Science;PEG;Homobifunctional PEGsMaterials Science;Biocompatible/Biodegradable Materials;Homobifunctional PEG BiomaterialsPolymer Science;New Products for Materials Research and Engineering;PEG Based Polymers;Poly(ethylene glycol) and Poly(ethylene oxide);Polymer Science;Crosslinking AgentsBiocompatible/Biodegradable Materials | | Mol File: | 26570-48-9.mol |  |
| | Poly(ethylene glycol) diacrylate Chemical Properties |
| Melting point | 12-17 °C | | density | 1.12 g/mL at 25 °C | | refractive index | n20/D 1.47 | | Fp | 347 °F | | storage temp. | -20°C | | solubility | H2O: soluble | | form | Granular Solid | | color | White to off-white | | Water Solubility | Soluble in water. | | Sensitive | Light Sensitive | | α-end | acrylate | | Ω-end | acrylate | | InChI | InChI=1S/C3H4O2.C2H6O2/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);3-4H,1-2H2 | | InChIKey | FCDZZFLRLVQGEH-UHFFFAOYSA-N | | SMILES | O([H])C([H])([H])C([H])([H])O[H].O([H])C(C([H])=C([H])[H])=O | | EPA Substance Registry System | Poly(oxy-1,2-ethanediyl), .alpha.-(1-oxo-2-propenyl)-.omega.-[(1-oxo-2-propenyl)oxy]- (26570-48-9) |
| Hazard Codes | Xi | | Risk Statements | 41-43-38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 1 | | TSCA | Yes | | HS Code | 2916.12.5050 |
| | Poly(ethylene glycol) diacrylate Usage And Synthesis |
| Description | Poly(ethylene glycol) diacrylate (PEGDA) is a blank slate hydrogel that gels rapidly at room temperature in the presence of a photoinitiator and light. PEGDA hydrogels are potent tools for uncovering basic cellular biology because they are considered biologically inert (“blank slate”), and their mechanical properties can be varied over an extensive range of moduli.PEGDA is an emerging scaffold for tissue engineering and regenerative medicine since polymerization can occur rapidly at room temperature, requires low energy input, has high water content, is elastic, and can be customized to include a variety of biological molecules. | | Uses | PEGDA is used in dental compounds, offset inks, varnishes and flexible coatings. | | Definition | ChEBI: Poly(ethylene glycol diacrylate) is a poly(ethylene glycol) compound terminated with acrylate groups. | | General Description | Poly(ethylene glycol) diacrylate (PEGDA) is a polyethylene glycol (PEG) based material that is used as a prepolymer solution that can be used in the formation of a cross-linked polymeric system. | | reaction suitability | reagent type: cross-linking reagent
reaction type: Polymerization Reactions |
| | Poly(ethylene glycol) diacrylate Preparation Products And Raw materials |
|