|
|
| | 2-Amino-2'-fluoro-5-nitrobenzophenone Basic information |
| | 2-Amino-2'-fluoro-5-nitrobenzophenone Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 485.6±45.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF: 2 mg/ml; DMSO: 1 mg/ml | | form | A crystalline solid | | pka | -3.19±0.36(Predicted) | | Appearance | Light yellow to orange Solid | | InChI | InChI=1S/C13H9FN2O3/c14-11-4-2-1-3-9(11)13(17)10-7-8(16(18)19)5-6-12(10)15/h1-7H,15H2 | | InChIKey | ZTEHQPVGEHUXHI-UHFFFAOYSA-N | | SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1F)=O | | CAS DataBase Reference | 344-80-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29223990 |
| | 2-Amino-2'-fluoro-5-nitrobenzophenone Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Intermediate in the production of Flunitrazepam metabolites. |
| | 2-Amino-2'-fluoro-5-nitrobenzophenone Preparation Products And Raw materials |
|