| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Rhodium(II) heptafluorobutyrate dimer Basic information |
| | Rhodium(II) heptafluorobutyrate dimer Chemical Properties |
| Melting point | >300 °C (lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | Major Application | PEM fuel cells homogeneous catalyst material synthesis precursor | | InChI | InChI=1S/4C4HF7O2.2Rh/c4*5-2(6,1(12)13)3(7,8)4(9,10)11;;/h4*(H,12,13);;/q;;;;2*+2/p-4 | | InChIKey | BNCXPORMMOBRMR-UHFFFAOYSA-J | | SMILES | C(F)(F)(C(=O)O[Rh]OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.C(F)(F)(C(=O)O[Rh]OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Rhodium(II) perfluorobutyrate dimer (73755-28-9) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Rhodium(II) heptafluorobutyrate dimer Usage And Synthesis |
| Uses | Recently used in the catalytic preparation of macrocycles and in the efficient synthesis of chiral β-substituted (E)-crotylsilanes. | | Application | Rhodium(ii) heptafluorobutyrate dimer is a catalyst that can be used for carbene reactions of diazo compounds, hydrosilylation of alkenes and alkynes, and silyl carbonylation of alkynes. | | Preparation | Rhodium(ii) heptafluorobutyrate dimer is prepared from Dirhodium(II) Tetraacetate by ligand displacement in refluxing perfluorobutyric acid containing perfluorobutyric anhydride. | | reaction suitability | reagent type: catalyst core: rhodium | | storage | air stable, very hygroscopic; stored in desiccator. |
| | Rhodium(II) heptafluorobutyrate dimer Preparation Products And Raw materials |
|