- 1,2,7,8-DIEPOXYOCTANE
-
- $30.00
-
2024-03-31
- CAS:2426-07-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000000
|
| | 1,2,7,8-Diepoxyoctane Basic information |
| Product Name: | 1,2,7,8-Diepoxyoctane | | Synonyms: | 1,2,7,8-Diepoxyoctane,97%;1,4-Di(oxiran-2-yl)butane;1,2,7,8-Diepoxyoctane (CAS:2426-07-5);1,4-Buthylenebis(oxirane);1,4-Butylenebis(oxirane);2,2'-(Butane-1,4-diyl)bisoxirane;2,2'-Tetramethylenebisoxirane;1,4-di(oxiran-2-yl)butane, 1,2,7,8-diepoxyoctane | | CAS: | 2426-07-5 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | 219-375-9 | | Product Categories: | Epoxide Monomers;Monomers;Oxiranes;Simple 3-Membered Ring Compounds;Polymer Science | | Mol File: | 2426-07-5.mol |  |
| | 1,2,7,8-Diepoxyoctane Chemical Properties |
| Melting point | 7°C | | Boiling point | 240 °C(lit.) | | density | 0.997 g/mL at 25 °C(lit.) | | vapor pressure | <1 hPa ( 20 °C) | | refractive index | n20/D 1.445(lit.) | | Fp | 208 °F | | storage temp. | Store below +30°C. | | solubility | 7g/l | | form | clear liquid | | Specific Gravity | 0.991.997 | | color | Colorless to Light yellow | | Water Solubility | Soluble in water (partly miscible), acetone and heptane. | | BRN | 104873 | | InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 | | InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N | | SMILES | C(C1CO1)CCCC1CO1 | | CAS DataBase Reference | 2426-07-5(CAS DataBase Reference) | | EPA Substance Registry System | Oxirane, 2,2'-(1,4-butanediyl)bis- (2426-07-5) |
| Hazard Codes | T | | Risk Statements | 22-24-68-45 | | Safety Statements | 36/37/39-45-53 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | RTECS | RG9450000 | | Autoignition Temperature | 350°C (DIN 51794) | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29109000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Carc. 1B Muta. 2 |
| | 1,2,7,8-Diepoxyoctane Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | suzuki reaction | | Uses | 1,2,7,8-Diepoxyoctane is used as an organic chemical synthesis intermediate. | | Definition | ChEBI: 1,2:7,8-diepoxyoctane is an epoxide. It has a role as a mutagen. It derives from a hydride of an octane. |
| | 1,2,7,8-Diepoxyoctane Preparation Products And Raw materials |
|