1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE manufacturers
|
| | 1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE Basic information |
| Product Name: | 1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE | | Synonyms: | 1,3,5-Tris(broMoMethyl)-2,4,6-triethylbenzene 98%;1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE;1,3,5-tri(broMoMethyl)-2,4,6-triethylbenzene;2,4,6-Triethyl-1,3,5-tris(bromomethyl)benzene;Benzene, 1,3,5-tris(bromomethyl)-2,4,6-triethyl-;1,3,5-tri(bromethyl)-2,4,6-triethylbenzene | | CAS: | 181058-08-2 | | MF: | C15H21Br3 | | MW: | 441.04 | | EINECS: | | | Product Categories: | pharmacetical;Alkyl;Halogenated Hydrocarbons;Organic Building Blocks;1 | | Mol File: | 181058-08-2.mol |  |
| | 1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE Chemical Properties |
| Melting point | 172-177 °C | | Boiling point | 392.3±37.0 °C(Predicted) | | density | 1.595±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | crystals | | Appearance | White to off-white Solid | | BRN | 7639256 | | InChI | 1S/C15H21Br3/c1-4-10-13(7-16)11(5-2)15(9-18)12(6-3)14(10)8-17/h4-9H2,1-3H3 | | InChIKey | UMKPSDHZXLYFJF-UHFFFAOYSA-N | | SMILES | CCc1c(CBr)c(CC)c(CBr)c(CC)c1CBr |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2 |
| | 1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE Usage And Synthesis |
| | 1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIETHYLBENZENE Preparation Products And Raw materials |
|