2,3-dihydroxypropyl 4-hydroxybenzoate manufacturers
|
| | 2,3-dihydroxypropyl 4-hydroxybenzoate Basic information |
| Product Name: | 2,3-dihydroxypropyl 4-hydroxybenzoate | | Synonyms: | 2,3-dihydroxypropyl 4-hydroxybenzoate;4-Hydroxybenzoic acid 2,3-dihydroxypropyl ester;BENZOIC ACID,4-HYDROXY-, 2,3-DIHYDROXYPROPYL ESTER;Methylparaben Impurity 4;Levetiracetam impurities4;Brivaracetam Impurity 95;Buvacitan impurity 5;Topiramate ImpuritiesF | | CAS: | 93778-15-5 | | MF: | C10H12O5 | | MW: | 212.2 | | EINECS: | 298-149-1 | | Product Categories: | | | Mol File: | 93778-15-5.mol |  |
| | 2,3-dihydroxypropyl 4-hydroxybenzoate Chemical Properties |
| Melting point | 154 °C | | Boiling point | 446.5±40.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.11±0.15(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H12O5/c11-5-9(13)6-15-10(14)7-1-3-8(12)4-2-7/h1-4,9,11-13H,5-6H2 | | InChIKey | BJLWPNKOAQTBGT-UHFFFAOYSA-N | | SMILES | C(OCC(O)CO)(=O)C1=CC=C(O)C=C1 |
| | 2,3-dihydroxypropyl 4-hydroxybenzoate Usage And Synthesis |
| Uses | 2,3-Dihydroxypropyl 4-hydroxybenzoate has antibacterial and antifungal properties and can be used as a preservative in cosmetics and personal care products to effectively extend the shelf life of the products. |
| | 2,3-dihydroxypropyl 4-hydroxybenzoate Preparation Products And Raw materials |
|