|
|
| | (2S)-2-(2-Oxopyrrolidin-1-yl)butanoic acid Basic information |
| | (2S)-2-(2-Oxopyrrolidin-1-yl)butanoic acid Chemical Properties |
| Melting point | 118-121°C | | Boiling point | 371.0±25.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Acetone (Slightly, Sonicated), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.76±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | -31.501°(C=0.01g/ml MEOH) | | InChI | InChI=1S/C8H13NO3/c1-2-6(8(11)12)9-5-3-4-7(9)10/h6H,2-5H2,1H3,(H,11,12) | | InChIKey | IODGAONBTQRGGG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(N1CCCC1=O)CC | | CAS DataBase Reference | 102849-49-0(CAS DataBase Reference) |
| | (2S)-2-(2-Oxopyrrolidin-1-yl)butanoic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Levetiracetam intermediate. | | Definition | ChEBI: Levetiracetam acid is an organooxygen compound and an organonitrogen compound. It is functionally related to an alpha-amino acid. |
| | (2S)-2-(2-Oxopyrrolidin-1-yl)butanoic acid Preparation Products And Raw materials |
|