| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane Basic information | | Uses |
| Product Name: | 2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane | | Synonyms: | 2,8 9-TRI-I-BUTYL-2,5,8 9-TETRAAZA-1-PHOSPHABICYCLO[3.3.3]UNDECANE;2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane,97%;Triisobutylazaphosphatrane;2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane 97%;2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane solution
;2,8,9-TRIISOBUTYL-2,5,8,9-TETRA AZA-1-P&;Tri-i-butyl-tetraaza-1-phosphabicyclo-undecane;2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane,97% | | CAS: | 331465-71-5 | | MF: | C18H39N4P | | MW: | 342.5 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 331465-71-5.mol | ![2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane Structure](CAS/GIF/331465-71-5.gif) |
| | 2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane Chemical Properties |
| Boiling point | 397.4±41.0 °C(Predicted) | | density | 0.964 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5020(lit.) | | Fp | 155 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.90±0.20(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Sensitive | air sensitive, moisture sensitive | | InChI | 1S/C18H39N4P/c1-16(2)13-20-10-7-19-8-11-21(14-17(3)4)23(20)22(12-9-19)15-18(5)6/h16-18H,7-15H2,1-6H3 | | InChIKey | WFHPXSHLCFHEIA-UHFFFAOYSA-N | | SMILES | CC(C)CN1CCN2CCN(CC(C)C)P1N(CC2)CC(C)C |
| | 2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane Usage And Synthesis |
| Uses | Exceedingly strong, non-ionic Brønsted and Lewis base useful in a variety of organic transformations.
| | Chemical Properties | Clear colorless to yellow liquid | | Uses | Triisobutylazaphosphatrane is reported to be used as a catalyst for the preparation of biaryl and alkenylarenes via Stille cross-coupling reaction. It also acts a catalyst for the synthesis of α-aryl-substituted nitriles. |
| | 2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane Preparation Products And Raw materials |
|