Chloroquine sulfate manufacturers
- Chloroquine sulfate
-
- $1.00 / 1KG
-
2020-02-02
- CAS:132-73-0
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons
|
| | Chloroquine sulfate Basic information |
| Product Name: | Chloroquine sulfate | | Synonyms: | lariago;melubrin;n(sub4)-(7-chloro-4-quinolinyl)-n(sub1),n(sub1)-diethyl-1,4-pentanediamine;n4-(7-chloro-4-quinolinyl)-n1,n1-diethyl-1,4-pentanediamine sulfate;chloroquine sulfate;CHLOROQUINESULPHATE;Chloroquine sulphate BP2000;1,4-pentanediamine,n(sub4)-(7-chloro-4-quinolinyl)-n(sub1),n(sub1)-diethy | | CAS: | 132-73-0 | | MF: | C18H28ClN3O4S | | MW: | 417.95 | | EINECS: | 205-077-6 | | Product Categories: | | | Mol File: | 132-73-0.mol |  |
| | Chloroquine sulfate Chemical Properties |
| Melting point | >204°C (dec.) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | BCS Class | 1 | | CAS DataBase Reference | 132-73-0(CAS DataBase Reference) |
| RIDADR | 1544 | | HazardClass | 6.1(b) | | PackingGroup | III | | Toxicity | women,TDLo,oral,120mg/kg (120mg/kg),SENSE ORGANS AND SPECIAL SENSES: MYDRIASIS (PUPILLARY DILATION): EYECARDIAC: CARDIOMYOPATHY INCLUDING INFARCTIONBEHAVIORAL: COMA,Journal of Toxicology, Clinical Toxicology. Vol. 29, Pg. 23, 1991. |
| | Chloroquine sulfate Usage And Synthesis |
| Uses | Antiprotozoal (malaria) | | Uses | Chloroquine Sulfate is a Chloroquine salt, used in the treatment of malaria and MDR-strains. It is a COVID19-related research product. |
| | Chloroquine sulfate Preparation Products And Raw materials |
|