- 3-(Trifluoromethoxy)
-
- $12.00 / 1KG
-
2021-11-15
- CAS:1014-81-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500ton/Month
|
| | 3-(Trifluoromethoxy)benzoic acid Basic information |
| | 3-(Trifluoromethoxy)benzoic acid Chemical Properties |
| Melting point | 89-92 °C (lit.) | | Boiling point | 203°C (rough estimate) | | density | 1.4251 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 3.82±0.10(Predicted) | | form | Powder | | color | White | | BRN | 2579574 | | InChI | InChI=1S/C8H5F3O3/c9-8(10,11)14-6-3-1-2-5(4-6)7(12)13/h1-4H,(H,12,13) | | InChIKey | OKPFIWIMBJNFSE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(OC(F)(F)F)=C1 | | CAS DataBase Reference | 1014-81-9(CAS DataBase Reference) | | NIST Chemistry Reference | M-trifluoromethoxybenzoic acid(1014-81-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-R36/37/38 | | Safety Statements | 26-36-37/39-S37/39-S26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(Trifluoromethoxy)benzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Kinetics of internal acyl migration and hydrolysis of the synthetic β-1-O-acyl-D-glucopyranuronates of 2-, 3-, and 4-(trifluoromethyl)benzoic acids in phosphate buffer was studied. | | General Description | Kinetics of internal acyl migration and hydrolysis of the synthetic β-1-O-acyl-D-glucopyranuronates of 2-, 3-, and 4-(trifluoromethyl)benzoic acids in phosphate buffer was studied. |
| | 3-(Trifluoromethoxy)benzoic acid Preparation Products And Raw materials |
|