|
|
| | 2-CHLOROADAMANTANE Basic information |
| Product Name: | 2-CHLOROADAMANTANE | | Synonyms: | 2-chlorotricyclo[3.3.1.13,7]decane;Adamantane, 2-chloro;adamantane,2-chloro-;2-CHLOROADAMANTANE;2-Chloradamantane;2-ADAMANTYL CHLORIDE;Tricyclo[3.3.1.13,7]decane, 2-chloro- | | CAS: | 7346-41-0 | | MF: | C10H15Cl | | MW: | 170.68 | | EINECS: | 230-868-8 | | Product Categories: | Adamantane derivatives | | Mol File: | 7346-41-0.mol |  |
| | 2-CHLOROADAMANTANE Chemical Properties |
| Melting point | 194-195℃ | | Boiling point | 241.2±9.0℃ (760 Torr) | | density | 1.12±0.1 g/cm3 (20 ºC 760 Torr) | | vapor pressure | 0.1±0.5 mmHg at 25°C | | refractive index | 1.529 | | Fp | 86.5±4.5℃ | | InChI | InChI=1S/C10H15Cl/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 | | InChIKey | DPCLLPAHJSYBTE-UHFFFAOYSA-N | | SMILES | C12CC3CC(CC(C3)C1Cl)C2 | | CAS DataBase Reference | 7346-41-0(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-CHLOROADAMANTANE Usage And Synthesis |
| Uses | 2-Chloroadamantane is an organic compound used mainly as a reaction reagent in chemical and experimental research. |
| | 2-CHLOROADAMANTANE Preparation Products And Raw materials |
|