| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Famciclovir Impurity 8
CAS:126589-69-3
Purity:> 95% Remarks:https://www.bocsci.com/product/famciclovir-impurity-8-cas-126589-69-3-471421.html
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Famciclovir Impurity 8
CAS:126589-69-3
Purity:>95%
|
| Company Name: |
Meng Cheng Technology (Shanghai) Co., LTD
|
| Tel: |
400-820-6829 |
| Email: |
sales@mitachieve.com |
| Products Intro: |
Product Name:9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine
CAS:126589-69-3
Purity:＞99% Package:100mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine
CAS:126589-69-3
Purity:NULL Package:100mg;10mg Remarks:NULL
|
|
| | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine Basic information |
| | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine Chemical Properties |
| InChI | InChI=1S/C14H19N5O4/c1-9(20)22-4-3-11(7-23-10(2)21)6-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) | | InChIKey | SSUXXYGTRYJLJW-UHFFFAOYSA-N | | SMILES | N1C2=C(N=C(N)N=C2)N(CC(COC(C)=O)CCOC(C)=O)C=1 |
| | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine Usage And Synthesis |
| Uses | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine is an impurity of Famciclovir. It?can be used to prepare antiviral purine-containing nucleoside analogs. | | General Description | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine, also known as Famciclovir Impurity 8, is an impurity of Framciclovir. It can be used in laboratory studies but not in animals or humans. |
| | 9-(4-Acetoxy-2-acetoxymethyl-but-1-yl)-2-aminopurine Preparation Products And Raw materials |
|