|
| OlMesartan DiMer Ester IMpurity Basic information |
| OlMesartan DiMer Ester IMpurity Chemical Properties |
Boiling point | 1101.2±75.0 °C(Predicted) | density | 1.35±0.1 g/cm3(Predicted) | pka | 2.13±0.50(Predicted) | form | Solid | color | Off-White | InChIKey | QTZDCAYLDWDQKW-UHFFFAOYSA-N | SMILES | C1(CCC)N(CC2=CC=C(C3=CC=CC=C3C3=NNN=N3)C=C2)C(C(OC(C2=C(C(O)=O)N(CC3=CC=C(C4=CC=CC=C4C4=NNN=N4)C=C3)C(CCC)=N2)(C)C)=O)=C(C(O)(C)C)N=1 |
| OlMesartan DiMer Ester IMpurity Usage And Synthesis |
Chemical Properties | Off-White Solid | Uses | A dimeric degradation product in stressed tablets of Olmesartan (O550001). |
| OlMesartan DiMer Ester IMpurity Preparation Products And Raw materials |
|