|
|
| | Tetrakis(hydroxymethyl)phosphonium sulfate Basic information |
| | Tetrakis(hydroxymethyl)phosphonium sulfate Chemical Properties |
| Melting point | -35°C | | Boiling point | 111°C | | density | 1.4 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 20℃ | | Fp | 96 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Specific Gravity | 1.42 | | color | Colorless to Almost colorless | | Water Solubility | >=10 g/100 mL at 18 ºC | | BRN | 8521357 | | Henry's Law Constant | 5.8×1017 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | InChI=1S/C4H12O4P.H2O4S/c5-1-9(2-6,3-7)4-8;1-5(2,3)4/h5-8H,1-4H2;(H2,1,2,3,4)/q+1;/p-1 | | InChIKey | HFDZMBPIARIWLN-UHFFFAOYSA-M | | SMILES | [P+](CO)(CO)(CO)CO.S([O-])(=O)(=O)O | | LogP | -9.8 | | CAS DataBase Reference | 55566-30-8(CAS DataBase Reference) | | EPA Substance Registry System | Tetrakis(hydroxymethyl)phosphonium sulfate (55566-30-8) |
| Hazard Codes | C,N,T | | Risk Statements | 22-34-43-50-41-20/22-45 | | Safety Statements | 26-36/37/39-45-61-53 | | RIDADR | UN 2922 8/PG 3 | | WGK Germany | 1 | | RTECS | TA2570000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29319019 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 1B Eye Dam. 1 Skin Sens. 1 | | Hazardous Substances Data | 55566-30-8(Hazardous Substances Data) |
| | Tetrakis(hydroxymethyl)phosphonium sulfate Usage And Synthesis |
| Description | Tetrakis(hydroxymethyl)phosphonium sulfate (THPS) is an organophosphorus compound. It is used as a precursor in the flame retardant manufacturing process, a biocide in water systems, and a tanning agent in the leather industry. THPS is a safe aqueous solution with antimicrobial properties that is significantly less toxic, effective at lower concentrations, and more biodegradable than other traditional biocides.
| | Uses | Tetrakis(hydroxymethyl)phosphonium sulfate is a green and environmentally friendly quaternary phosphonium salt bactericide, mainly used as a biocidal agent. It is widely used in water treatment, oil fields, papermaking and other industries. Its outstanding advantage is that it can be rapidly degraded into completely harmless substances after use, greatly reducing the environmental impact of these industries. It is also an internationally recognized permanent flame retardant for pure cotton and polyester-cotton fabrics. | | General Description | Clear colorless viscous liquid. | | Air & Water Reactions | Water soluble. | | Reactivity Profile | Tetrakis(hydroxymethyl)phosphonium sulfate is incompatible with oxidizing materials and alkalis. | | Fire Hazard | Tetrakis(hydroxymethyl)phosphonium sulfate is probably combustible. | | Flammability and Explosibility | Non flammable | | Synthesis | Add sulfuric acid and formaldehyde into the reaction kettle, open the gas-liquid circulation mixing reaction pump, add phosphine into the gas-liquid circulation mixing reaction pump, at 50-60 through the gas-liquid circulation mixing reaction device to absorb phosphine, phosphine is not completely absorbed into the next gas-liquid circulation mixing reaction pump (the two gas-liquid circulation mixing reaction device is the same, just connected in series, so that it is more conducive to the use of phosphine), the reaction end point is determined by the central control detection of formaldehyde content, and then concentrated by decompression to get tetrahydroxymethylphosphine sulfate. Detect the content of formaldehyde through the central control to determine the end point of the reaction, after the end of the reaction by decompression and concentration to get tetrakis(hydroxymethyl)phosphine sulfate. | | Advantages | Advantage of the wet white tanned leathers, using THPS offers: a light color and pastel shades They can reach shrink temperatures of at least 70 grad C High softness Good lightness Feeling of naturalness Pleasant to the touch Beauty that lasts for a long time Can be burned without the risk of hexavalent chromium formation
|
| | Tetrakis(hydroxymethyl)phosphonium sulfate Preparation Products And Raw materials |
|