| Company Name: |
Henan Tianfu Chemical Co.,Ltd. |
| Tel: |
+86-0371-55170693 +86-19937530512 |
| Email: |
info@tianfuchem.com |
| Products Intro: |
Product Name:2043-53-0 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-10-iododecane
CAS:2043-53-0
Purity:99% Package:25KG;5KG;1KG
|
|
|
|
|
| Company Name: |
Fluoropharm Co., Ltd. |
| Tel: |
+86-0571-85586753 +86-13336034509 |
| Email: |
sales@fluoropharm.com |
| Products Intro: |
Product Name:1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-10-iododecane
CAS:2043-53-0
Purity:0.98 Package:25KG;5KG;1KG
|
|
|
|
|
|
| | 1-Iodo-1H,1H,2H,2H-perfluorodecane Basic information | | Description |
| Product Name: | 1-Iodo-1H,1H,2H,2H-perfluorodecane | | Synonyms: | 1h,1h,2h,2h-perfluorodecyl;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-10-IODODECANE;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-iodo-decan;1H,1H,2H,2H-PERFLUORODECYL IODIDE;1H,1H,2H,2H-PERFLUORO-1-DECYL IODIDE;1H,1H,2H,2H-Perfluorodecyl Iodide
1H,1H,2H,2H-Heptadecafluoro-1-iododecane
1H,1H,2H,2H-Perfluoro-1-iododecane;1-Iodo-1H,1H,2H,2H-perfluorodecane 96%;2-(PERFLUOROOCTYL)ETHYL IODIDE | | CAS: | 2043-53-0 | | MF: | C10H4F17I | | MW: | 574.02 | | EINECS: | 218-053-5 | | Product Categories: | Chemical Synthesis;Halogenated Hydrocarbons;Organic Fluorides;Alkyl;Building Blocks;Organic Building Blocks;organofluorine compounds | | Mol File: | 2043-53-0.mol |  |
| | 1-Iodo-1H,1H,2H,2H-perfluorodecane Chemical Properties |
| Melting point | 54-58 °C(lit.) | | Boiling point | 178 °C | | density | 1.88 | | Fp | 92-96°C/12mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | solid | | color | white | | Water Solubility | Insoluble in water. | | Sensitive | Light Sensitive | | BRN | 1894667 | | Henry's Law Constant | 1.2×10-9 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | Stability: | Stable. | | InChI | 1S/C10H4F17I/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1-2H2 | | InChIKey | XVKJSLBVVRCOIT-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI | | CAS DataBase Reference | 2043-53-0(CAS DataBase Reference) | | EPA Substance Registry System | Decane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-iodo- (2043-53-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | IRRITANT-HARMFUL | | HS Code | 29037800 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| Provider | Language |
|
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-10-iododecane
| English |
|
SigmaAldrich
| English |
|
ACROS
| English |
|
ALFA
| English |
| | 1-Iodo-1H,1H,2H,2H-perfluorodecane Usage And Synthesis |
| Description | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-iodoheptane (also known as 1-Iodo-1H,1H,2H,2H-perfluorodecane or 1H,1H,2H,2H-Perfluorodecyliodide) is an organic fluorine fabric finishing agent. The organic fluorine fabric finishing agent has excellent water and oil repellency, air permeability and washing resistance, anti-fouling, and easy decontamination properties. | | Chemical Properties | solid | | Uses | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-10-iododecane is used in that preparation of a chemical compounds employed in high-performance organic thin-film transistors. It also finds it application as an appliance in boat and building paint. | | General Description | 1-Iodo-1H,1H,2H,2H-perfluorodecane was identified as Persistent Organic Pollutant (POP) and was listed as high-production-volume chemical (HPVC). | | Synthesis | Perfluorooctane iodide (520 g, 1.16 mmol), Na2S2O4 (20.9 g, 0.12 mol), Na2HPO4 (21.5 g),
Acetonitrile (900 mL) and water (300 mL) were added to a 2 L autoclave and ethylene gas was passed to bring the pressure to 40 atm. at 40-45
C for 3 hrs, a significant decrease in ethylene pressure was observed.19F NMR tracking of the reaction revealed that the feedstock had reacted
The reaction was stopped, the excess ethylene gas was discharged, the lower organic layer was separated, washed with water, washed with saturated brine, and then dried with anhydrous sodium sulfate .
Sodium sulfate, drying, vacuum removal of organic solvents, the compound perfluorooctane ethyl iodide was obtained as a white solid (525 g, yield 95%, mp56-57 C). |
| | 1-Iodo-1H,1H,2H,2H-perfluorodecane Preparation Products And Raw materials |
|