| Identification | Back Directory | [Name]
Ir[dFppy]2(dtbbpy)PF6 | [CAS]
1072067-44-7 | [Synonyms]
-κC]iridium hexafL Ir[dFppy]2(dtbbpy)PF6 (Ir[dFppy]2(dtbpy))PF6 [4,4'-Bis(1,1-dimethyL C]iridium hexafluorophosphate, 97% )-2,2'-bipyridine-κN,κN]bis[3,5-difL 2-(2,4-difluorobenzene-6-id-1-yl)pyridine [2,2'-bis (4-tert-butylpyridine)] bis [2- (2,4-difluorophenyl) pyridine] iridium (III) hexafluorophosphate [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine-κN,κN]bis[3,5-difluoro-2-(2-pyridinyl-κN)phenyl-κC]iridium hexafluorophosphate, 97% iridium(3+) ion bis(3,5-difluoro-2-(pyridin-2-yl)benzen-1-ide) 4-tert-butyl-2-(4-tert-butylpyridin-2-yl)pyridine hexafluoro-lambda5-phosphanuide Ir[dFppy]2(dtbbpy)PF6,4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine-κN,κN]bis[3,5-difluoro-2-(2-pyridinyl-κN)phenyl-κC]iridium hexafluorophosphate | [Molecular Formula]
C40H36F10IrN4P | [MDL Number]
MFCD31657504 | [MOL File]
1072067-44-7.mol | [Molecular Weight]
985.93 |
| Chemical Properties | Back Directory | [Melting point ]
>300°C | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
powder or crystals | [InChIKey]
YTFMVASKFDAIDY-UHFFFAOYSA-N | [SMILES]
[P+5]([F-])([F-])([F-])([F-])([F-])[F-].FC1C=C(F)C=[C-]2[Ir+3]34(N5=CC=CC=C5C5=C(C=C(F)C=[C-]35)F)(N3=CC=C(C(C)(C)C)C=C3C3=CC(C(C)(C)C)=CC=N43)N3=CC=CC=C3C=12 |
| Hazard Information | Back Directory | [Uses]
This photocatalyst readily facilitates alkynylation of carboxylic acids as well as the decarboxylative cross-coupling of oxalates via metallaphotoredox catalysis. | [reaction suitability]
core: iridium reagent type: catalyst reaction type: Photocatalysis |
|
| Company Name: |
Adamas Reagent, Ltd. Gold
|
| Tel: |
400-6009262 16621234537 |
| Website: |
http://www.tansoole.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|