| Identification | Back Directory | [Name]
Ir[p-F(t-Bu)-ppy]3 | [CAS]
1311386-93-2 | [Synonyms]
) -4-tert-butyL
Ir[p-F(t-Bu)-ppy]3
Tris (2- (3-tert-butyL
fac-Ir((3-tBu-phenyl)-4-tBu-py))3
Tris (2- (3-tert-butylphenyl) -4-tert-butylpyridine) iridium | [Molecular Formula]
C45H45F3IrN3 | [MOL File]
1311386-93-2.mol | [Molecular Weight]
877.09 |
| Chemical Properties | Back Directory | [Melting point ]
372.5°C | [form ]
powder or crystals | [InChI]
1S/3C15H15FN.Ir/c3*1-15(2,3)12-8-9-17-14(10-12)11-4-6-13(16)7-5-11;/h3*4,6-10H,1-3H3; | [InChIKey]
KBFAZTBWJUCETR-UHFFFAOYSA-N | [SMILES]
[Ir](c5c(ccc(c5)F)c6nccc(c6)C(C)(C)C)(c3c(ccc(c3)F)c4nccc(c4)C(C)(C)C)c1c(ccc(c1)F)c2nccc(c2)C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
Ir[p-F(t-Bu)-ppy]3 is a photocatalyst which readily facilitates the decarboxylative arylation of α amino acids using visible light. | [reaction suitability]
core: iridium
reaction type: Photocatalysis
reagent type: catalyst |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|