| Identification | Back Directory | [Name]
Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) | [CAS]
500295-52-3 | [Synonyms]
-κN)-5-(trifL Ir(p-CF3-ppy)3 -κC]iridium(III) fac-Ir(p-CF3ppy)3 Tris[2-(2-pyridinyL Ir(p-CF3-ppy)3 >=95% Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) TRIS[(2-(2-PYRIDINYL-KN)-5-(TRIFLUOROMETHYL)PHENYL-KC]IRIDIUM(III),95% Tris[(2-(2-pyridinyl-kN)-5-(trifluoromethyl)phenyl-kC]iridium(III), 95% | [Molecular Formula]
C36H21F9IrN3 | [MDL Number]
MFCD31657272 | [MOL File]
500295-52-3.mol | [Molecular Weight]
858.79 |
| Chemical Properties | Back Directory | [Melting point ]
>300°C | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [color ]
yellow | [Sensitive ]
air sensitive | [InChI]
1S/3C12H7F3N.Ir/c3*13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;/h3*1-4,6-8H; | [InChIKey]
ZLVNAIXHGHEODI-UHFFFAOYSA-N | [SMILES]
[Ir]741([NH]8=C(c9c7cc(cc9)C(F)(F)F)C=CC=C8)([NH]5=C(c6c4cc(cc6)C(F)(F)F)C=CC=C5)[NH]2=C(c3c1cc(cc3)C(F)(F)F)C=CC=C2 |
| Hazard Information | Back Directory | [Uses]
This photocatalyst facilitates a variety of transformations using visible light, including the defluorination of arenes. | [reaction suitability]
core: iridium reagent type: catalyst reaction type: Photocatalysis |
|
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|