| Identification | Back Directory | [Name]
H2N-PEG12-CH2CH2COOH | [CAS]
1415408-69-3 | [Synonyms]
Amino-dPEG???-acid
37-Amino-4,7,10,13,16,19,22,25,28,31,34,37-dodecaoxanonatriacontanoic acid | [Molecular Formula]
C27H55NO14 | [MDL Number]
MFCD11041150 | [MOL File]
1415408-69-3.mol | [Molecular Weight]
617.73 |
| Chemical Properties | Back Directory | [Boiling point ]
665.8±55.0 °C(Predicted) | [density ]
1.125±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light | [solubility ]
Soluble in Water, DMSO, DMF | [form ]
Solid | [pka]
4.28±0.10(Predicted) | [color ]
White to off-white | [InChI]
InChI=1S/C27H55NO14/c28-2-4-32-6-8-34-10-12-36-14-16-38-18-20-40-22-24-42-26-25-41-23-21-39-19-17-37-15-13-35-11-9-33-7-5-31-3-1-27(29)30/h1-26,28H2,(H,29,30) | [InChIKey]
NLXRBQLQDLAFIM-UHFFFAOYSA-N | [SMILES]
C(COCCOCCOCCC(=O)O)OCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| Hazard Information | Back Directory | [Description]
Amino-PEG12-acid is an aqueous soluble PEG reagent. NH2 group is reactive with activated NHS esters, carbonyls (ketone, aldehyde) etc. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | [Uses]
Amino-PEG12-Acid-Hydrochloride can be useful in enzymeless DNA base identification by chemical stepping in a nanopore. | [IC 50]
PEGs |
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|