| Identification | Back Directory | [Name]
4-(Diphenylamino)phenylboronic acid | [CAS]
201802-67-7 | [Synonyms]
4-BATPA 4-(Diphenylamino)phe 4-borate triphenylamine Triphenylamine-4-boronic Acid 4-(Diphenylamino)phenylboronic acid 4-(N-phenylanilino)phenyl]boronicaci 4-(N-Diphenylamino)phenylboronic acid [4-(N-phenylanilino)phenyl]boronic acid B-[4-(Diphenylamino)phenyl]boronic acid 4-(N,N-Diphenylamino)phenylboronic acid 4-(DiphenylaMino)benzeneboronic acid, 98% BORONIC ACID,B-[4-(DIPHENYLAMINO)PHENYL]- 4-(N,N-Diphenylamino)-1-phenylboronic acid 4-Diphenylamino-phenylboronic acid or Triphenylami 4-(Diphenylamino)phenylboronic Acid (contains varying amounts of Anhydride) 4-(DIPHENYLAMINO)PHENYLBORONIC ACID, (CONTAINS VARYING AMOUNTS OF ANHYDRIDE),97.0%(T) Boronic acid, B-[4-(diphenylaMino)phenyl]-
Boronic acid, [4-(diphenylaMino)phenyl]- (9CI) | [Molecular Formula]
C18H16BNO2 | [MDL Number]
MFCD06798117 | [MOL File]
201802-67-7.mol | [Molecular Weight]
289.14 |
| Chemical Properties | Back Directory | [Melting point ]
110-115 °C | [Boiling point ]
484.5±47.0 °C(Predicted) | [density ]
1.24±0.1 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Sealed in dry,Room Temperature | [solubility ]
soluble in Toluene | [form ]
powder | [pka]
8.71±0.17(Predicted) | [color ]
White to Dark green | [InChI]
InChI=1S/C18H16BNO2/c21-19(22)15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,21-22H | [InChIKey]
TWWQCBRELPOMER-UHFFFAOYSA-N | [SMILES]
B(C1=CC=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C=C1)(O)O |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
|