| Identification | Back Directory | [Name]
Alisol B acetate | [CAS]
26575-95-1 | [Synonyms]
Acetylalisol B Alisol B acetate 23-Acetyl alisol B 23-Acetylalismol B 23-O-Acetylalisol B ALISOL B ACETATE(SH) Alisol B 23-acetate, AlisolB23-Monoacetate Alisol B (23-acetate) (23-Acetylalismol B Alisol acetate B, 98%, from Alisma plantago-aquatica Linn. (8α,9β,14β,23S,24R)-23-Acetoxy-24,25-epoxy-11β-hydroxydammar-13(17)-en-3-one (8α,9β,14β,23S,24R)-11β-Hydroxy-23-acetoxy-24,25-epoxy-5α-dammara-13(17)-ene-3-one (23S,24R)-24,25-Epoxy-11b,23-dihydroxy-8a,9b,14b-dammar-13(17)-en-3-one 23-acetate Dammar-13(17)-en-3-one, 23-(acetyloxy)-24,25-epoxy-11-hydroxy-, (8α,9β,11β,14β,23S,24R)- [1-(3,3-dimethyloxiran-2-yl)-3-[(8S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl] acetate (1S,3R)-1-((R)-3,3-dimethyloxiran-2-yl)-3-((5R,8S,9S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl acetate | [Molecular Formula]
C32H50O5 | [MDL Number]
MFCD06798979 | [MOL File]
26575-95-1.mol | [Molecular Weight]
514.74 |
| Chemical Properties | Back Directory | [Melting point ]
162~163℃ | [Boiling point ]
590.7±50.0 °C(Predicted) | [density ]
1.12±0.1 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Sealed in dry,2-8°C | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
14.74±0.70(Predicted) | [color ]
White | [Major Application]
food and beverages | [InChIKey]
NLOAQXKIIGTTRE-CAMIZLLSNA-N | [SMILES]
C[C@]12CC[C@@]3([H])C(C(=O)CC[C@]3(C)[C@]1([H])[C@H](CC1=C([C@H](C)C[C@@H]([C@@]3([H])OC3(C)C)OC(=O)C)CC[C@]21C)O)(C)C |&1:1,4,11,13,15,19,22,23,35,r| |
| Safety Data | Back Directory | [Safety Statements ]
24/25 | [WGK Germany ]
WGK 3 | [HS Code ]
29153900 | [Storage Class]
11 - Combustible Solids | [Hazard Classifications]
Acute Tox. 4 Oral |
| Hazard Information | Back Directory | [Chemical Properties]
White crystalline powder, soluble in methanol, derived from Alisma orientalis. | [Uses]
Alisol B 23-Acetate is effective in reversing the multi-drug resistance of specific over-expressing P-glycoprotein cancer cells. An herbal triterpene extract that is useful in the treatment of cancers, primarily prostate cancer. | [Definition]
ChEBI: Alisol b acetate is a triterpenoid. |
|
|