| Identification | Back Directory | [Name]
Ethyl 4-hydroxypyrimidine-5-carboxylate | [CAS]
4786-52-1 | [Synonyms]
7-chloroisoquinolin-1(2H)-one ethyl 6-oxo-1H-pyrimidine-5-carboxylate ETHYL 4-HYDROXYPYRIMIDINE-5-CARBOXYLATE 4-hydroxy-5-pyrimidinecarboxylicaciethylester Ethyl 1,4-dihydro-4-oxo-5-pyrimidinecarboxylate 6-Hydroxypyrimidine-5-carboxylic acid ethyl ester 6-keto-1H-pyrimidine-5-carboxylic acid ethyl ester 4-HYDROXY-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER Ethyl 6-oxo-1,6-dihydropyrimidine-5-carboxylate LR 6-OXO-1,6-DIHYDRO-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER Ethyl 4-hydroxypyrimidine-5-carboxylate ISO 9001:2015 REACH 5-Pyrimidinecarboxylic acid, 1,6-dihydro-6-oxo-, ethyl ester 5-Pyrimidinecarboxylic acid, 1,4-dihydro-4-oxo-, ethyl ester 4-Hydroxy-pyrimidine-5-carboxylic acid ethyl ester (HCl salt) | [Molecular Formula]
C7H8N2O3 | [MDL Number]
MFCD00235034 | [MOL File]
4786-52-1.mol | [Molecular Weight]
168.15 |
| Chemical Properties | Back Directory | [Melting point ]
185-186 °C | [density ]
1.33±0.1 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,Room Temperature | [pka]
7.70±0.40(Predicted) | [Appearance]
Light yellow to yellow Solid | [InChI]
InChI=1S/C7H8N2O3/c1-2-12-7(11)5-3-8-4-9-6(5)10/h3-4H,2H2,1H3,(H,8,9,10) | [InChIKey]
PLMIZYMXBHSARX-UHFFFAOYSA-N | [SMILES]
C1NC(=O)C(C(OCC)=O)=CN=1 |
| Hazard Information | Back Directory | [Uses]
7-Chloroisoquinolin-1(2H)-one acts as a reagent for the preparation, SAR of methoxyisoquinoline derivative and discovery of asunaprevir (BMS-650032), an orally efficacious NS3 protease inhibitor for the treatment of hepatitis C virus infection. Synthesis and pharmacological evaluation of a series of 1,2-dihydro-1-[(5-methyl-1-imidazol-4-yl)methyl]-2-oxopyridine 5-HT3 antagonists. | [Synthesis]
Ethyl 4-hydroxy-5-pyrimidinecarboxylate was prepared as follows: Add 1.6g (70mmol) of sodium metal to 50mL of anhydrous ethanol, wait for the reaction to be complete, ice-water bath cooled to 0°C, add 7.3g (70mmol) formamidine acetate, foll |
|
| Company Name: |
Shangchem Co., Ltd.
|
| Telephone: |
+86-21-68182121 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14031/0_EN.htm |
| Company Name: |
Tetranov Biopharm
|
| Telephone: |
13526569071 |
| Website: |
http://www.leadmedpharm.com/index.html |
| Company Name: |
China Langchem Inc.
|
| Telephone: |
0086-21-58956006 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm |
| Company Name: |
skychemical Co.Ltd
|
| Telephone: |
021-20958197 20965099 |
| Website: |
www.skychemical.com |
| Company Name: |
Heterochem
|
| Telephone: |
027-88041443 13072715837 |
| Website: |
www.hetero-chem.com |
|