| Company Name: |
Alfa Aesar
|
| Tel: |
1 888 343-8025 Specialty/Bulk |
| Email: |
|
| Products Intro: |
Cas:77-94-1
ProductName:Tri-n-butyl citrate
Brand: Alfa Aesar | Product Number: A10266
|
| Company Name: |
Shanghai Beiwanta Biotechnology Co., Ltd.
|
| Tel: |
021-67187366 19901745723 |
| Email: |
info@bwtlab.com |
| Products Intro: |
Cas:77-94-1
ProductName:Tri-n-butyl citrate
Purity: 99% | Package: 1mg;5mg;10mg;50mg
|
| Company Name: |
Shanghai Saikerui Biotechnology Co. , Ltd.
|
| Tel: |
021-58000709 15900491054 |
| Email: |
info@scrbio.com |
| Products Intro: |
Cas:77-94-1
ProductName:Tri-n-butyl citrate
Purity: 99% | Package: 1mg;5mg;10mg;50mg
|
- Citrate
-
- $1.00 / 1kg
-
2022-03-30
- CAS:77-92-9
- Min. Order: 1kg
- Purity: ≥99.5%
- Supply Ability: 2000
|
| Product Name: | Butyl Citrate | | Synonyms: | N-BUTYLCITRATE;TRIBUTYL CITRATE;TRIPHENYLBENZYLPHOSPHONIUM CHLORIDE;1,2,3-Propanetricarboxylic acid, 2-hydroxy-, tributyl ester;1,2,3-Propanetricarboxylicacid,2-hydroxy-,tributylester;2,3-propanetricarboxylicacid,2-hydroxy-tributylester;2-Hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester;TributylCitrate99+% | | CAS: | 77-94-1 | | MF: | C18H32O7 | | MW: | 360.44 | | EINECS: | 201-071-2 | | Product Categories: | fine chemicals;Amino ester;Functional Materials;Hydroxycarboxylic Acid Esters (Plasticizer);Plasticizer;77-94-1;K00001 | | Mol File: | 77-94-1.mol |  |
| | Butyl Citrate Chemical Properties |
| Melting point | ≥300 °C(lit.) | | Boiling point | 234 °C (17 mmHg) | | density | 1.043 g/mL at 20 °C (lit.) | | Pour Point | -62 | | refractive index | n20/D 1.445 | | Fp | 300 °C | | storage temp. | Store below +30°C. | | solubility | Miscible with acetone, ethanol, and vegetable oil;
practically insoluble in water. | | pka | 11.30±0.29(Predicted) | | form | Liquid | | color | Clear | | Odor | odorless | | Water Solubility | insoluble | | Merck | 14,1564 | | BRN | 1806072 | | Cosmetics Ingredients Functions | SOLVENT
PLASTICISER
FILM FORMING | | InChI | 1S/C18H32O7/c1-4-7-10-23-15(19)13-18(22,17(21)25-12-9-6-3)14-16(20)24-11-8-5-2/h22H,4-14H2,1-3H3 | | InChIKey | ZFOZVQLOBQUTQQ-UHFFFAOYSA-N | | SMILES | CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC | | LogP | 4.324 (est) | | CAS DataBase Reference | 77-94-1(CAS DataBase Reference) | | NIST Chemistry Reference | Butyl citrate(77-94-1) | | EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, tributyl ester (77-94-1) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | TZ8608000 | | TSCA | TSCA listed | | HS Code | 29181500 | | Storage Class | 10 - Combustible liquids |
| | Butyl Citrate Usage And Synthesis |
| Chemical Properties | Butyl Citrate (TBC) is a clear, colorless to yellow, liquid at ambient temperatures. The material has a slight, characteristic odor. | | Uses | Butyl Citrate is primarily for use as a plasticizer for
polyactic acid, cellulose acetate, and vinyl. The organic compound is
used as an intermediate or additive in the production of products including
cosmetics, polyvinyl chloride (PVC) flooring, and bottle caps. | | Hazard | Butyl Citrate is stable under normal conditions of use. Prevent contact with oxidizing agents,
esters, and nitrates. Avoid heat, open flames and other potential sources of ignition. Heating to
decomposition may release carbon monoxide and carbon dioxide. |
| | Butyl Citrate Preparation Products And Raw materials |
|