| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- BOC-ASP-OH
-
- $15.00
-
2021-08-12
- CAS:4587-33-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- BOC-ASP-OH
-
- $7.00
-
2019-09-02
- CAS: 4587-33-1
- Min. Order: 1KG
- Purity: 99%
|
| | Boc-Asn-ONp Basic information |
| Product Name: | Boc-Asn-ONp | | Synonyms: | n2-[(1,1-dimethylethoxy)carbonyl]-l-asparagin4-nitrophenylester;Na-BOC-L-asparagine P-Nitrophenyl Ester;N-(tert-butoxycarbonyl)-L-asparagine 4-nitrophenyl ester;N2-(tert-Butoxycarbonyl)-L-asparagine 4-nitrophenyl ester;N2-[(1,1-Dimethylethoxy)carbonyl]-L-asparagine 4-nitrophenyl ester;N-α-Boc-L-asparagine 4-nitrophenyl ester;NA-BOC-L-ASPARAGINE4-NITROPEHNYLESTER;NALPHA-tert-Butoxycarbonyl-L-asparagine-4-nitrophenyl ester | | CAS: | 4587-33-1 | | MF: | C15H19N3O7 | | MW: | 353.33 | | EINECS: | 237-294-7 | | Product Categories: | Asparagine [Asn, N];Boc-Amino Acids and Derivative;Amino Acids;Boc-Amino acid series | | Mol File: | 4587-33-1.mol |  |
| | Boc-Asn-ONp Chemical Properties |
| Melting point | 116-118 °C(lit.) | | Boiling point | 609.3±55.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | slightly sol. in Methanol | | form | Powder | | pka | 10.57±0.46(Predicted) | | color | White to off-white | | InChI | InChI=1S/C15H19N3O7/c1-15(2,3)25-14(21)17-11(8-12(16)19)13(20)24-10-6-4-9(5-7-10)18(22)23/h4-7,11H,8H2,1-3H3,(H2,16,19)(H,17,21)/t11-/m0/s1 | | InChIKey | IAPXDJMULQXGDD-NSHDSACASA-N | | SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)[C@H](CC(N)=O)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 4587-33-1(CAS DataBase Reference) | | EPA Substance Registry System | L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-, 4-nitrophenyl ester (4587-33-1) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HS Code | 29242990 |
| | Boc-Asn-ONp Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Boc-Asn-ONp, is an Asparagine derivative used in peptide chemistry. | | Definition | ChEBI: Boc-Asn-OPhNO2 is a L-asparagine derivative, a primary carboxamide, a carbamate ester and a C-nitro compound. It is functionally related to a 4-nitrophenol. |
| | Boc-Asn-ONp Preparation Products And Raw materials |
|