| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2'-Bromo-4'-fluoroacetophenone Basic information |
| | 2'-Bromo-4'-fluoroacetophenone Chemical Properties |
| Melting point | 48-50°C | | Boiling point | 150°C 12mm | | density | 1.535±0.06 g/cm3(Predicted) | | refractive index | 1.549 | | Fp | 110°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Chloroform, Methanol | | form | liquid | | color | Clear, pale lemon | | BRN | 2249797 | | InChI | InChI=1S/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 | | InChIKey | RCXFSBRMWBFWMH-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(F)C=C1Br)C | | CAS DataBase Reference | 1006-39-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | Hazard Note | Irritant | | HS Code | 2914790090 |
| Provider | Language |
|
ALFA
| English |
| | 2'-Bromo-4'-fluoroacetophenone Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil |
| | 2'-Bromo-4'-fluoroacetophenone Preparation Products And Raw materials |
|