|
|
| | N-Methyl-p-toluenesulfonamide Basic information |
| | N-Methyl-p-toluenesulfonamide Chemical Properties |
| Melting point | 76-79 °C (lit.) | | Boiling point | 296.5±33.0 °C(Predicted) | | density | 1.3400 | | refractive index | 1.5650 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) | | pka | 11.67±0.30(Predicted) | | form | Crystalline Solid | | color | White to light yellow | | InChI | InChI=1S/C8H11NO2S/c1-7-3-5-8(6-4-7)12(10,11)9-2/h3-6,9H,1-2H3 | | InChIKey | GWLOGZRVYXAHRE-UHFFFAOYSA-N | | SMILES | C1(S(NC)(=O)=O)=CC=C(C)C=C1 | | CAS DataBase Reference | 640-61-9(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenesulfonamide, n,4-dimethyl-(640-61-9) | | EPA Substance Registry System | Benzenesulfonamide, N,4-dimethyl- (640-61-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids |
| | N-Methyl-p-toluenesulfonamide Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline solid | | Uses | N-Methyl-p-toluenesulfonamide was used in the synthesis of vicinal haloamino ketone derivative. | | Uses | N-Methyl-p-toluenesulfonamide is an intermediate used in the synthesis of vicinal haloamino ketone derivative. | | Reactions | N-Methyl-p-toluenesulfonamide (p-TsNHCH₃), acting as a nitrogen source, forms a catalyst-free amine bromination system with N-bromosuccinimide (NBS), which is used to directly convert various alkenes (including aromatic, aliphatic, and cyclic alkenes) into o-bromoamines[1].
 | | References | [1] Guangqian Zhang . (2010). Catalyst-free aminobromination of alkenes with N-methyl-p-toluenesulfonamide as nitrogen resource. Tetrahedron Letters, 51 6, Pages 987-989. https://doi.org/10.1016/j.tetlet.2009.12.059 |
| | N-Methyl-p-toluenesulfonamide Preparation Products And Raw materials |
|